CAS 57640-76-3 appears in our catalog under these names: (6-Bromo-1-oxohexyl)ferrocene, 95+%, (6-Bromo-1-oxohexyl)ferrocene 95%, (6-BROMO-1-OXOHEXYL)FERROCENE. Offered by: Chemat Brand, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g, 5g.
6-bromo-1-cyclopenta-2,4-dien-1-ylidenehexan-1-olate;cyclopenta-1,3-diene;iron(2+) (CAS 57640-76-3) is a chemical compound with the molecular formula C16H19BrFeO and a molecular weight of 363.07 g/mol. IUPAC name: 6-bromo-1-cyclopenta-2,4-dien-1-ylidenehexan-1-olate;cyclopenta-1,3-diene;iron(2+). InChIKey: FNTAMLHOTKQXBR-UHFFFAOYSA-M.
| Molecular formula | C16H19BrFeO |
|---|---|
| Molecular weight | 363.07 g/mol |
| IUPAC name | 6-bromo-1-cyclopenta-2,4-dien-1-ylidenehexan-1-olate;cyclopenta-1,3-diene;iron(2+) |
| InChIKey | FNTAMLHOTKQXBR-UHFFFAOYSA-M |
| SMILES | [CH-]1C=CC=C1.C1=CC(=C(CCCCCBr)[O-])C=C1.[Fe+2] |
Computed by PubChem (NCBI)