Products 57645-05-3
CAS 57645-05-3 is the registry number for Sermetacin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]-3-hydroxypropanoic acid (CAS 57645-05-3) is a chemical compound with the molecular formula C22H21ClN2O6 and a molecular weight of 444.9 g/mol. IUPAC name: (2S)-2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]-3-hydroxypropanoic acid. InChIKey: AUDFHJLSHQWFQQ-SFHVURJKSA-N.
| Molecular formula | C22H21ClN2O6 |
|---|---|
| Molecular weight | 444.9 g/mol |
| IUPAC name | (2S)-2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]-3-hydroxypropanoic acid |
| InChIKey | AUDFHJLSHQWFQQ-SFHVURJKSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)N[C@@H](CO)C(=O)O |
Computed by PubChem (NCBI)