CAS 57645-56-4 is the registry number for 1-(4-Chlorobenzyl)piperidin-4-amine dihydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-[(4-chlorophenyl)methyl]piperidin-4-amine;dihydrochloride (CAS 57645-56-4) is a chemical compound with the molecular formula C12H19Cl3N2 and a molecular weight of 297.6 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]piperidin-4-amine;dihydrochloride. InChIKey: ZDJCTQHGLVJPMN-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl3N2 |
|---|---|
| Molecular weight | 297.6 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]piperidin-4-amine;dihydrochloride |
| InChIKey | ZDJCTQHGLVJPMN-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)CC2=CC=C(C=C2)Cl.Cl.Cl |
Computed by PubChem (NCBI)