CAS 57647-79-7 appears in our catalog under these names: Benclonidine, 95%, Benclonidine, Benclonidine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 100mg, 25mg.
[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]-phenylmethanone (CAS 57647-79-7) is a chemical compound with the molecular formula C16H13Cl2N3O and a molecular weight of 334.2 g/mol. IUPAC name: [2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]-phenylmethanone. InChIKey: YHEMKMZUJKPOCO-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2N3O |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | [2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]-phenylmethanone |
| InChIKey | YHEMKMZUJKPOCO-UHFFFAOYSA-N |
| SMILES | C1CN(C(=N1)NC2=C(C=CC=C2Cl)Cl)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)