Products 577-27-5
CAS 577-27-5 appears in our catalog under these names: Ledol, Ledol, 95.00%, (+)-Ledol, 98.00% ,, 98.00% ,, Ledol, 98.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 1g, 500mg, 2mg, 50 mg, 10 mg.
(1aS,4S,4aR,7S,7aR,7bR)-1,1,4,7-tetramethyl-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-4-ol (CAS 577-27-5) is a chemical compound with the molecular formula C15H26O and a molecular weight of 222.37 g/mol. IUPAC name: (1aS,4S,4aR,7S,7aR,7bR)-1,1,4,7-tetramethyl-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-4-ol. InChIKey: AYXPYQRXGNDJFU-AQEIEYEASA-N.
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (1aS,4S,4aR,7S,7aR,7bR)-1,1,4,7-tetramethyl-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-4-ol |
| InChIKey | AYXPYQRXGNDJFU-AQEIEYEASA-N |
| SMILES | C[C@H]1CC[C@@H]2[C@H]1[C@@H]3[C@@H](C3(C)C)CC[C@]2(C)O |
Computed by PubChem (NCBI)