CAS 57709-63-4 is the registry number for 1,10-Phenanthroline-2,9-dicarbonitrile 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
1,10-phenanthroline-2,9-dicarbonitrile (CAS 57709-63-4) is a chemical compound with the molecular formula C14H6N4 and a molecular weight of 230.22 g/mol. IUPAC name: 1,10-phenanthroline-2,9-dicarbonitrile. InChIKey: JNOOPFIMFWABMI-UHFFFAOYSA-N.
| Molecular formula | C14H6N4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 1,10-phenanthroline-2,9-dicarbonitrile |
| InChIKey | JNOOPFIMFWABMI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C=CC(=N3)C#N)N=C(C=C2)C#N |
Computed by PubChem (NCBI)