CAS 57709-77-0 is the registry number for 4–(4–Chlorophenyl)–2–phenylphthalazin–1(2H)–one. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
4-(4-chlorophenyl)-2-phenylphthalazin-1-one (CAS 57709-77-0) is a chemical compound with the molecular formula C20H13ClN2O and a molecular weight of 332.8 g/mol. IUPAC name: 4-(4-chlorophenyl)-2-phenylphthalazin-1-one. InChIKey: QAXBJEHARAXYIA-UHFFFAOYSA-N.
| Molecular formula | C20H13ClN2O |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2-phenylphthalazin-1-one |
| InChIKey | QAXBJEHARAXYIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3C(=N2)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)