CAS 57718-28-2 appears in our catalog under these names: (5-CHLORO-2-HYDROXYPHENYL)UREA, 95%, 1-(5-chloro-2-hydroxyphenyl)urea, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g.
(5-chloro-2-hydroxyphenyl)urea (CAS 57718-28-2) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: (5-chloro-2-hydroxyphenyl)urea. InChIKey: XNYTZADDSVJMRC-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | (5-chloro-2-hydroxyphenyl)urea |
| InChIKey | XNYTZADDSVJMRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)NC(=O)N)O |
Computed by PubChem (NCBI)