CAS 57729-86-9 is the registry number for Desmethyl Bromethalin, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline (CAS 57729-86-9) is a chemical compound with the molecular formula C13H5Br3F3N3O4 and a molecular weight of 563.90 g/mol. IUPAC name: 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline. InChIKey: INVHIPJJDSPNJY-UHFFFAOYSA-N.
| Molecular formula | C13H5Br3F3N3O4 |
|---|---|
| Molecular weight | 563.90 g/mol |
| IUPAC name | 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline |
| InChIKey | INVHIPJJDSPNJY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)NC2=C(C=C(C=C2Br)Br)Br)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)