CAS 57738-99-5 is the registry number for Palladium, dichlorobis(quinoline)-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dichloropalladium;quinoline (CAS 57738-99-5) is a chemical compound with the molecular formula C18H14Cl2N2Pd and a molecular weight of 435.6 g/mol. IUPAC name: dichloropalladium;quinoline. InChIKey: WNRIITWJLQUJOM-UHFFFAOYSA-L.
| Molecular formula | C18H14Cl2N2Pd |
|---|---|
| Molecular weight | 435.6 g/mol |
| IUPAC name | dichloropalladium;quinoline |
| InChIKey | WNRIITWJLQUJOM-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C=CC=N2.C1=CC=C2C(=C1)C=CC=N2.Cl[Pd]Cl |
Computed by PubChem (NCBI)