Products 57741-47-6
CAS 57741-47-6 is the registry number for Acid red 266. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 6-amino-5-[[4-chloro-2-(trifluoromethyl)phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate (CAS 57741-47-6) is a chemical compound with the molecular formula C17H10ClF3N3NaO4S and a molecular weight of 467.8 g/mol. IUPAC name: sodium 6-amino-5-[[4-chloro-2-(trifluoromethyl)phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate. InChIKey: GVLHHJPRNMDLLL-UHFFFAOYSA-M.
| Molecular formula | C17H10ClF3N3NaO4S |
|---|---|
| Molecular weight | 467.8 g/mol |
| IUPAC name | sodium 6-amino-5-[[4-chloro-2-(trifluoromethyl)phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate |
| InChIKey | GVLHHJPRNMDLLL-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C2=C(C=C(C=C21)S(=O)(=O)[O-])O)N=NC3=C(C=C(C=C3)Cl)C(F)(F)F)N.[Na+] |
Computed by PubChem (NCBI)