Products 57745-26-3

CAS 57745-26-3 is the registry number for 2,4-Diethyl 5-(bromomethyl)-3-methyl-1H-pyrrole-2,4-dicarboxylate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

Diethyl 5-(bromomethyl)-3-methyl-1H-pyrrole-2,4-dicarboxylate (CAS 57745-26-3) is a chemical compound with the molecular formula C12H16BrNO4 and a molecular weight of 318.16 g/mol. IUPAC name: diethyl 5-(bromomethyl)-3-methyl-1H-pyrrole-2,4-dicarboxylate. InChIKey: YFNAQTXYIOAWOW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16BrNO4
Molecular weight318.16 g/mol
IUPAC namediethyl 5-(bromomethyl)-3-methyl-1H-pyrrole-2,4-dicarboxylate
InChIKeyYFNAQTXYIOAWOW-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(NC(=C1C)C(=O)OCC)CBr

Computed by PubChem (NCBI)