CAS 5776-78-3 appears in our catalog under these names: Aminocaproic Acid Trimer Impurity, 6-(6-(6-Aminohexanamido)hexanamido)hexanoic Acid, >95% (HPLC), 6-(6-(6-Aminohexanamido)hexanamido)hexanoic acid, 6-(6-(6-Aminohexanamido)hexanamido)hexanoic acid 97%, AMINOCAPROIC ACID RELATED COMPOUND B. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 100mg, 1g, 250mg, 50mg, 0,5g, 25MG, 5g.
6-[6-(6-aminohexanoylamino)hexanoylamino]hexanoic acid (CAS 5776-78-3) is a chemical compound with the molecular formula C18H35N3O4 and a molecular weight of 357.5 g/mol. IUPAC name: 6-[6-(6-aminohexanoylamino)hexanoylamino]hexanoic acid. InChIKey: JOIUZBTWMAYEQW-UHFFFAOYSA-N.
| Molecular formula | C18H35N3O4 |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | 6-[6-(6-aminohexanoylamino)hexanoylamino]hexanoic acid |
| InChIKey | JOIUZBTWMAYEQW-UHFFFAOYSA-N |
| SMILES | C(CCC(=O)NCCCCCC(=O)NCCCCCC(=O)O)CCN |
Computed by PubChem (NCBI)