CAS 57775-25-4 is the registry number for Calcium Dobesilate Impurity 4 Bis-diethylamine Salt. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dihydroxybenzene-1,4-disulfonic acid;bis(N-ethylethanamine) (CAS 57775-25-4) is a chemical compound with the molecular formula C14H28N2O8S2 and a molecular weight of 416.5 g/mol. IUPAC name: 2,5-dihydroxybenzene-1,4-disulfonic acid;bis(N-ethylethanamine). InChIKey: XYUSESXYUHHDPC-UHFFFAOYSA-N.
| Molecular formula | C14H28N2O8S2 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | 2,5-dihydroxybenzene-1,4-disulfonic acid;bis(N-ethylethanamine) |
| InChIKey | XYUSESXYUHHDPC-UHFFFAOYSA-N |
| SMILES | CCNCC.CCNCC.C1=C(C(=CC(=C1S(=O)(=O)O)O)S(=O)(=O)O)O |
Computed by PubChem (NCBI)