CAS 577773-09-2 appears in our catalog under these names: Isowyosine, >95% (HPLC), Isowyosine, 7-Methyl wyosine. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 5mg, 25mg, 50 mg, 100 mg, 10 mg.
3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,7-dimethyl-5H-imidazo[1,2-a]purin-9-one (CAS 577773-09-2) is a chemical compound with the molecular formula C14H17N5O5 and a molecular weight of 335.32 g/mol. IUPAC name: 3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,7-dimethyl-5H-imidazo[1,2-a]purin-9-one. InChIKey: BINGDNLMMYSZFR-QYVSTXNMSA-N.
| Molecular formula | C14H17N5O5 |
|---|---|
| Molecular weight | 335.32 g/mol |
| IUPAC name | 3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,7-dimethyl-5H-imidazo[1,2-a]purin-9-one |
| InChIKey | BINGDNLMMYSZFR-QYVSTXNMSA-N |
| SMILES | CC1=C(N2C(=O)C3=C(N=C2N1)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O)C |
Computed by PubChem (NCBI)