CAS 577778-82-6 appears in our catalog under these names: Topiroxostat Impurity 6, Topiroxostat Impurity 9, Topiroxostat Impurity 3, Topiroxostat Impurity F. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
4-[5-(1-hydroxy-4-pyridinylidene)-1,2,4-triazol-3-yl]pyridine-2-carbonitrile (CAS 577778-82-6) is a chemical compound with the molecular formula C13H8N6O and a molecular weight of 264.24 g/mol. IUPAC name: 4-[5-(1-hydroxy-4-pyridinylidene)-1,2,4-triazol-3-yl]pyridine-2-carbonitrile. InChIKey: DZWHXHCLXFPDRQ-UHFFFAOYSA-N.
| Molecular formula | C13H8N6O |
|---|---|
| Molecular weight | 264.24 g/mol |
| IUPAC name | 4-[5-(1-hydroxy-4-pyridinylidene)-1,2,4-triazol-3-yl]pyridine-2-carbonitrile |
| InChIKey | DZWHXHCLXFPDRQ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C2=NC(=C3C=CN(C=C3)O)N=N2)C#N |
Computed by PubChem (NCBI)