CAS 57778-93-5 appears in our catalog under these names: 3-Aminoindole hydrochloride, 95%, 1H-Indol-3-amine Hydrochloride, 3-aminoindole HCl 98%, 3-Aminoindole Hydrochloride, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 500mg, 50mg, 100mg, 5g.
1H-indol-3-amine;hydrochloride (CAS 57778-93-5) is a chemical compound with the molecular formula C8H9ClN2 and a molecular weight of 168.62 g/mol. IUPAC name: 1H-indol-3-amine;hydrochloride. InChIKey: NAJOKFIOBSENCX-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2 |
|---|---|
| Molecular weight | 168.62 g/mol |
| IUPAC name | 1H-indol-3-amine;hydrochloride |
| InChIKey | NAJOKFIOBSENCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)N.Cl |
Computed by PubChem (NCBI)