CAS 57804-27-0 is the registry number for Geranylgeranyl Phenyl Sulfide. Offered by: TRC. Available pack sizes: 100mg, 10mg.
[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylbenzene (CAS 57804-27-0) is a chemical compound with the molecular formula C26H38S and a molecular weight of 382.6 g/mol. IUPAC name: [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylbenzene. InChIKey: MYTISHNKWOCLGO-GHDNBGIDSA-N.
| Molecular formula | C26H38S |
|---|---|
| Molecular weight | 382.6 g/mol |
| IUPAC name | [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylbenzene |
| InChIKey | MYTISHNKWOCLGO-GHDNBGIDSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CSC1=CC=CC=C1)/C)/C)/C)C |
Computed by PubChem (NCBI)