CAS 5781-02-2 is the registry number for 5-tert-Butyl-2-methylphenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-tert-butyl-2-methylphenol (CAS 5781-02-2) is a chemical compound with the molecular formula C11H16O and a molecular weight of 164.24 g/mol. IUPAC name: 5-tert-butyl-2-methylphenol. InChIKey: FLSBACIXSFRPLT-UHFFFAOYSA-N.
| Molecular formula | C11H16O |
|---|---|
| Molecular weight | 164.24 g/mol |
| IUPAC name | 5-tert-butyl-2-methylphenol |
| InChIKey | FLSBACIXSFRPLT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)(C)C)O |
Computed by PubChem (NCBI)