CAS 57830-48-5 appears in our catalog under these names: 2-(Trifluoromethylthio)benzaldehyde, 95%, 2-(Trifluoromethylthio)benzaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg.
2-(trifluoromethylsulfanyl)benzaldehyde (CAS 57830-48-5) is a chemical compound with the molecular formula C8H5F3OS and a molecular weight of 206.19 g/mol. IUPAC name: 2-(trifluoromethylsulfanyl)benzaldehyde. InChIKey: JQSKYLMRBFOYTR-UHFFFAOYSA-N.
| Molecular formula | C8H5F3OS |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 2-(trifluoromethylsulfanyl)benzaldehyde |
| InChIKey | JQSKYLMRBFOYTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)SC(F)(F)F |
Computed by PubChem (NCBI)