CAS 57830-60-1 appears in our catalog under these names: 1,3-Diiodo-5-nitrobenzene, 95%, 1,3-Diiodo-5-nitrobenzene, 1,3-Diiodo-5-nitrobenzene, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 0,5g.
1,3-diiodo-5-nitrobenzene (CAS 57830-60-1) is a chemical compound with the molecular formula C6H3I2NO2 and a molecular weight of 374.90 g/mol. IUPAC name: 1,3-diiodo-5-nitrobenzene. InChIKey: JIVYEUNBDFYQRD-UHFFFAOYSA-N.
| Molecular formula | C6H3I2NO2 |
|---|---|
| Molecular weight | 374.90 g/mol |
| IUPAC name | 1,3-diiodo-5-nitrobenzene |
| InChIKey | JIVYEUNBDFYQRD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1I)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)