CAS 578727-68-1 appears in our catalog under these names: MK 0686, MK 0686, 99.76%. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 25 mg, 10 mg, 5 mg.
Methyl 2-chloro-6-[3-fluoro-4-[(1R)-1-[[1-[(2,2,2-trifluoroacetyl)amino]cyclopropanecarbonyl]amino]ethyl]phenyl]benzoate (CAS 578727-68-1) is a chemical compound with the molecular formula C22H19ClF4N2O4 and a molecular weight of 486.8 g/mol. IUPAC name: methyl 2-chloro-6-[3-fluoro-4-[(1R)-1-[[1-[(2,2,2-trifluoroacetyl)amino]cyclopropanecarbonyl]amino]ethyl]phenyl]benzoate. InChIKey: WZZIQHIQMWJNLU-LLVKDONJSA-N.
| Molecular formula | C22H19ClF4N2O4 |
|---|---|
| Molecular weight | 486.8 g/mol |
| IUPAC name | methyl 2-chloro-6-[3-fluoro-4-[(1R)-1-[[1-[(2,2,2-trifluoroacetyl)amino]cyclopropanecarbonyl]amino]ethyl]phenyl]benzoate |
| InChIKey | WZZIQHIQMWJNLU-LLVKDONJSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)C2=C(C(=CC=C2)Cl)C(=O)OC)F)NC(=O)C3(CC3)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)