CAS 57903-15-8 appears in our catalog under these names: 2-(Methylsulfonyl)ethyl n-succinimidyl carbonate, 95%, Methylsulfonylethyl Succinimidyl Carbonate, 2,5-Dioxopyrrolidin-1-yl (2-(methylsulfonyl)ethyl) carbonate, 97%, 2–(Methylsulfonyl)ethyl n–succinimidyl carbonate, 2-(METHYLSULFONYL)ETHYL N-SUCCINIMIDYL CARBONATE, 97%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 100 mg, 250 mg.
(2,5-dioxopyrrolidin-1-yl) 2-methylsulfonylethyl carbonate (CAS 57903-15-8) is a chemical compound with the molecular formula C8H11NO7S and a molecular weight of 265.24 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-methylsulfonylethyl carbonate. InChIKey: KSMLVLJMKBLJJL-UHFFFAOYSA-N.
| Molecular formula | C8H11NO7S |
|---|---|
| Molecular weight | 265.24 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-methylsulfonylethyl carbonate |
| InChIKey | KSMLVLJMKBLJJL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCOC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)