CAS 57931-93-8 is the registry number for (5-Chlorothiophen-2-yl)(4-fluorophenyl)methanone. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(5-chlorothiophen-2-yl)-(4-fluorophenyl)methanone (CAS 57931-93-8) is a chemical compound with the molecular formula C11H6ClFOS and a molecular weight of 240.68 g/mol. IUPAC name: (5-chlorothiophen-2-yl)-(4-fluorophenyl)methanone. InChIKey: JSAZWHDIHGLVEJ-UHFFFAOYSA-N.
| Molecular formula | C11H6ClFOS |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | (5-chlorothiophen-2-yl)-(4-fluorophenyl)methanone |
| InChIKey | JSAZWHDIHGLVEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(S2)Cl)F |
Computed by PubChem (NCBI)