CAS 57946-62-0 appears in our catalog under these names: 3,5-Dichloro-4-(2,2,2-trifluoroethoxy)aniline, 95%, 3,5-Dichloro-4-(2,2,2-trifluoroethoxy)aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
3,5-dichloro-4-(2,2,2-trifluoroethoxy)aniline (CAS 57946-62-0) is a chemical compound with the molecular formula C8H6Cl2F3NO and a molecular weight of 260.04 g/mol. IUPAC name: 3,5-dichloro-4-(2,2,2-trifluoroethoxy)aniline. InChIKey: CMFQYFKDPZLFAO-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2F3NO |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 3,5-dichloro-4-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | CMFQYFKDPZLFAO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)OCC(F)(F)F)Cl)N |
Computed by PubChem (NCBI)