CAS 57946-90-4 appears in our catalog under these names: 2-Bromo-4-methanesulfonylaniline, 95%, 2-Bromo-4-(methylsulfonyl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
2-bromo-4-methylsulfonylaniline (CAS 57946-90-4) is a chemical compound with the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. IUPAC name: 2-bromo-4-methylsulfonylaniline. InChIKey: BZKULEPZXDVWPQ-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO2S |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 2-bromo-4-methylsulfonylaniline |
| InChIKey | BZKULEPZXDVWPQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)N)Br |
Computed by PubChem (NCBI)