CAS 579470-00-1 is the registry number for Daidzein 7-Sulfate Potassium Salt. Offered by: TRC. Available pack sizes: 25mg.
CAS 579470-00-1 identifies a chemical compound with the molecular formula C15H10KO7S and a molecular weight of 373.4 g/mol. InChIKey: KFWINVRUHICRGE-UHFFFAOYSA-N.
| Molecular formula | C15H10KO7S |
|---|---|
| Molecular weight | 373.4 g/mol |
| InChIKey | KFWINVRUHICRGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)OS(=O)(=O)O)O.[K] |
Computed by PubChem (NCBI)