CAS 57955-51-8 is the registry number for 1-(3,5-bis(trifluoromethyl)phenyl)cyclopentanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[3,5-bis(trifluoromethyl)phenyl]cyclopentan-1-ol (CAS 57955-51-8) is a chemical compound with the molecular formula C13H12F6O and a molecular weight of 298.22 g/mol. IUPAC name: 1-[3,5-bis(trifluoromethyl)phenyl]cyclopentan-1-ol. InChIKey: SKMWMSISIKUZGR-UHFFFAOYSA-N.
| Molecular formula | C13H12F6O |
|---|---|
| Molecular weight | 298.22 g/mol |
| IUPAC name | 1-[3,5-bis(trifluoromethyl)phenyl]cyclopentan-1-ol |
| InChIKey | SKMWMSISIKUZGR-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)O |
Computed by PubChem (NCBI)