CAS 57963-59-4 is the registry number for 2,4-Pteridinediamine-6-methanol Hydrobromide. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
(2,4-diaminopteridin-6-yl)methanol;hydrobromide (CAS 57963-59-4) is a chemical compound with the molecular formula C7H9BrN6O and a molecular weight of 273.09 g/mol. IUPAC name: (2,4-diaminopteridin-6-yl)methanol;hydrobromide. InChIKey: GLCVATFASXGJHN-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN6O |
|---|---|
| Molecular weight | 273.09 g/mol |
| IUPAC name | (2,4-diaminopteridin-6-yl)methanol;hydrobromide |
| InChIKey | GLCVATFASXGJHN-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C(=NC(=NC2=N1)N)N)CO.Br |
Computed by PubChem (NCBI)