Products 5798-71-0

CAS 5798-71-0 is the registry number for 1-(4-Bromophenyl)ethanone oxime, 97%, 97%. Offered by: Chemat. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

N-[1-(4-bromophenyl)ethylidene]hydroxylamine (CAS 5798-71-0) is a chemical compound with the molecular formula C8H8BrNO and a molecular weight of 214.06 g/mol. IUPAC name: N-[1-(4-bromophenyl)ethylidene]hydroxylamine. InChIKey: AWJKRPKYUKWTJX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrNO
Molecular weight214.06 g/mol
IUPAC nameN-[1-(4-bromophenyl)ethylidene]hydroxylamine
InChIKeyAWJKRPKYUKWTJX-UHFFFAOYSA-N
SMILESCC(=NO)C1=CC=C(C=C1)Br

Computed by PubChem (NCBI)