CAS 57981-01-8 appears in our catalog under these names: 2-[(2,3,4,5,6-Pentafluorophenyl)methoxy]phthalimide, 95%, 2-((Perfluorophenyl)methoxy)isoindoline-1,3-dione, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 1g, 25g, on request.
2-[(2,3,4,5,6-pentafluorophenyl)methoxy]isoindole-1,3-dione (CAS 57981-01-8) is a chemical compound with the molecular formula C15H6F5NO3 and a molecular weight of 343.20 g/mol. IUPAC name: 2-[(2,3,4,5,6-pentafluorophenyl)methoxy]isoindole-1,3-dione. InChIKey: PAQCVKRZNWHXJP-UHFFFAOYSA-N.
| Molecular formula | C15H6F5NO3 |
|---|---|
| Molecular weight | 343.20 g/mol |
| IUPAC name | 2-[(2,3,4,5,6-pentafluorophenyl)methoxy]isoindole-1,3-dione |
| InChIKey | PAQCVKRZNWHXJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OCC3=C(C(=C(C(=C3F)F)F)F)F |
Computed by PubChem (NCBI)