Products 57987-84-5

CAS 57987-84-5 is the registry number for methyl 6-methyl-3,4-dihydro-2H-pyran-5-carboxylate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 6-methyl-3,4-dihydro-2H-pyran-5-carboxylate (CAS 57987-84-5) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: methyl 6-methyl-3,4-dihydro-2H-pyran-5-carboxylate. InChIKey: GPYBLZCROOSNOX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O3
Molecular weight156.18 g/mol
IUPAC namemethyl 6-methyl-3,4-dihydro-2H-pyran-5-carboxylate
InChIKeyGPYBLZCROOSNOX-UHFFFAOYSA-N
SMILESCC1=C(CCCO1)C(=O)OC

Computed by PubChem (NCBI)