CAS 5799-67-7 appears in our catalog under these names: Dimethyl(methylthio)sulfonium tetrafluoroborate, 95%, Dimethyl(methylthio)sulfonium Tetrafluoroborate, Dimethyl(methylthio)sulfonium Tetrafluoroborate, Dimethyl(methylthio)sulfonium Tetrafluoroborate, >97.0%(T), DIMETHYL(METHYLTHIO)SULFONIUM TETRA-FLUO. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 5g, 1g, 200mg, 0,5g, 2g, 10g.
Dimethyl(methylsulfanyl)sulfanium tetrafluoroborate (CAS 5799-67-7) is a chemical compound with the molecular formula C3H9BF4S2 and a molecular weight of 196.0 g/mol. IUPAC name: dimethyl(methylsulfanyl)sulfanium tetrafluoroborate. InChIKey: LUOOXKXNWLQGLY-UHFFFAOYSA-N.
| Molecular formula | C3H9BF4S2 |
|---|---|
| Molecular weight | 196.0 g/mol |
| IUPAC name | dimethyl(methylsulfanyl)sulfanium tetrafluoroborate |
| InChIKey | LUOOXKXNWLQGLY-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CS[S+](C)C |
Computed by PubChem (NCBI)