CAS 57999-06-1 appears in our catalog under these names: 4-Phenyl-1H-pyrazol-5-amine 98%, 4-Phenyl-1H-pyrazol-5-amine, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
4-phenyl-1H-pyrazol-5-amine (CAS 57999-06-1) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: 4-phenyl-1H-pyrazol-5-amine. InChIKey: QEHKQNYBBLCFIJ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | 4-phenyl-1H-pyrazol-5-amine |
| InChIKey | QEHKQNYBBLCFIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(NN=C2)N |
Computed by PubChem (NCBI)