CAS 57999-08-3 appears in our catalog under these names: 5–Amino–4–(4–bromophenyl)pyrazole, 4-(4-Bromophenyl)-1H-pyrazol-5-amine, ≥97%, ≥97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.
4-(4-bromophenyl)-1H-pyrazol-5-amine (CAS 57999-08-3) is a chemical compound with the molecular formula C9H8BrN3 and a molecular weight of 238.08 g/mol. IUPAC name: 4-(4-bromophenyl)-1H-pyrazol-5-amine. InChIKey: ABKUXQSVMWMABM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3 |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 4-(4-bromophenyl)-1H-pyrazol-5-amine |
| InChIKey | ABKUXQSVMWMABM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(NN=C2)N)Br |
Computed by PubChem (NCBI)