CAS 58047-42-0 appears in our catalog under these names: 4–Bromo–4',4''–dimethyltriphenylamine, 4-Bromo-4',4''-dimethyltriphenylamine, >95.0%(GC), 4-Bromo-4,4-dimethyltriphenylamine 99%, 4-Bromo-4',4''-dimethyltriphenylamine, 99%, 99%, 4-Bromo-N,N-di-p-tolylaniline, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 50g.
N-(4-bromophenyl)-4-methyl-N-(4-methylphenyl)aniline (CAS 58047-42-0) is a chemical compound with the molecular formula C20H18BrN and a molecular weight of 352.3 g/mol. IUPAC name: N-(4-bromophenyl)-4-methyl-N-(4-methylphenyl)aniline. InChIKey: YMNJJMJHTXGFOR-UHFFFAOYSA-N.
| Molecular formula | C20H18BrN |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | N-(4-bromophenyl)-4-methyl-N-(4-methylphenyl)aniline |
| InChIKey | YMNJJMJHTXGFOR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)