CAS 58054-88-9 is the registry number for 3,3-Dimethyl-1-nitrobutan-2-ol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-dimethyl-1-nitrobutan-2-ol (CAS 58054-88-9) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: 3,3-dimethyl-1-nitrobutan-2-ol. InChIKey: POPUCNRCMDNMTD-UHFFFAOYSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | 3,3-dimethyl-1-nitrobutan-2-ol |
| InChIKey | POPUCNRCMDNMTD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C[N+](=O)[O-])O |
Computed by PubChem (NCBI)