CAS 5806-10-0 appears in our catalog under these names: 9-Butyl-9h-fluoren-9-ol, 95%, 9–butyl–9H–fluoren–9–ol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-(4-nitro-2,1,3-benzoselenadiazol-5-yl)morpholine (CAS 5806-10-0) is a chemical compound with the molecular formula C10H10N4O3Se and a molecular weight of 313.18 g/mol. IUPAC name: 4-(4-nitro-2,1,3-benzoselenadiazol-5-yl)morpholine. InChIKey: BCMLYKXCMYFAKS-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O3Se |
|---|---|
| Molecular weight | 313.18 g/mol |
| IUPAC name | 4-(4-nitro-2,1,3-benzoselenadiazol-5-yl)morpholine |
| InChIKey | BCMLYKXCMYFAKS-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C3=N[Se]N=C3C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)