CAS 58073-59-9 appears in our catalog under these names: Ipratropium Bromide EP Impurity B Bromide (Ipratropium Bromide USP Related Compound B), Ipratropium EP Impurity B, Ipratropium Bromide EP Impurity B, Ipratropium Bromide Impurity 2(Ipratropium EP Impurity B), 8-anti-Ipratropium Bromide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate bromide (CAS 58073-59-9) is a chemical compound with the molecular formula C20H30BrNO3 and a molecular weight of 412.4 g/mol. IUPAC name: (8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate bromide. InChIKey: LHLMOSXCXGLMMN-UHFFFAOYSA-M.
| Molecular formula | C20H30BrNO3 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | (8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate bromide |
| InChIKey | LHLMOSXCXGLMMN-UHFFFAOYSA-M |
| SMILES | CC(C)[N+]1(C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3)C.[Br-] |
Computed by PubChem (NCBI)