CAS 581-24-8 appears in our catalog under these names: 2-Trifluoromethylphenazine, 95%, 2-Trifluoromethylphenazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 25mg, 10mg, 50mg.
2-(trifluoromethyl)phenazine (CAS 581-24-8) is a chemical compound with the molecular formula C13H7F3N2 and a molecular weight of 248.20 g/mol. IUPAC name: 2-(trifluoromethyl)phenazine. InChIKey: XSCVJNIZCHWXSU-UHFFFAOYSA-N.
| Molecular formula | C13H7F3N2 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 2-(trifluoromethyl)phenazine |
| InChIKey | XSCVJNIZCHWXSU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C=CC(=CC3=N2)C(F)(F)F |
Computed by PubChem (NCBI)