CAS 58105-66-1 appears in our catalog under these names: Acifluorfen-methyl-2-amino, >95% (HPLC), Acifluorfen-methyl-2-amino. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 500mg, 50mg, 25mg.
Methyl 2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate (CAS 58105-66-1) is a chemical compound with the molecular formula C15H11ClF3NO3 and a molecular weight of 345.70 g/mol. IUPAC name: methyl 2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate. InChIKey: PLOQUFPZQGEZJP-UHFFFAOYSA-N.
| Molecular formula | C15H11ClF3NO3 |
|---|---|
| Molecular weight | 345.70 g/mol |
| IUPAC name | methyl 2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate |
| InChIKey | PLOQUFPZQGEZJP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)OC2=C(C=C(C=C2)C(F)(F)F)Cl)N |
Computed by PubChem (NCBI)