CAS 58106-26-6 appears in our catalog under these names: 4-Methoxy-2,5-dimethylbenzoic acid, 95%, 4-Methoxy-2,5-dimethylbenzoic acid, 98%, 4-Methoxy-2,5-dimethylbenzoic acid, 98%, 98%, 2,5-Dimethyl-4-methoxybenzoic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 2.5g.
4-methoxy-2,5-dimethylbenzoic acid (CAS 58106-26-6) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 4-methoxy-2,5-dimethylbenzoic acid. InChIKey: WXUIXMXEFZKIBM-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 4-methoxy-2,5-dimethylbenzoic acid |
| InChIKey | WXUIXMXEFZKIBM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)C)C(=O)O |
Computed by PubChem (NCBI)