CAS 581076-66-6 is the registry number for Imatinib Impurity 60. Offered by: Chemat Brand. Available pack sizes: on request.
4-(dichloromethyl)-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide (CAS 581076-66-6) is a chemical compound with the molecular formula C24H19Cl2N5O and a molecular weight of 464.3 g/mol. IUPAC name: 4-(dichloromethyl)-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide. InChIKey: UCRXVCYNKHFUJO-UHFFFAOYSA-N.
| Molecular formula | C24H19Cl2N5O |
|---|---|
| Molecular weight | 464.3 g/mol |
| IUPAC name | 4-(dichloromethyl)-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
| InChIKey | UCRXVCYNKHFUJO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)C(Cl)Cl)NC3=NC=CC(=N3)C4=CN=CC=C4 |
Computed by PubChem (NCBI)