CAS 58111-94-7 appears in our catalog under these names: Fmoc-Arg(NO2)-OH, 95%, Fmoc–Arg(NO2)–OH, Fmoc-L-Arg(NO2)-OH, Fmoc-Arg(NO2)-OH 97%, Fmoc-Arg(NO2)-OH, 96%, 96%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 25g, 100g, 500g, 5g, 50g.
(2S)-5-[[amino(nitramido)methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 58111-94-7) is a chemical compound with the molecular formula C21H23N5O6 and a molecular weight of 441.4 g/mol. IUPAC name: (2S)-5-[[amino(nitramido)methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: RXMHIKWOZKQXCJ-SFHVURJKSA-N.
| Molecular formula | C21H23N5O6 |
|---|---|
| Molecular weight | 441.4 g/mol |
| IUPAC name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | RXMHIKWOZKQXCJ-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCN=C(N)N[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)