Products 58142-10-2
CAS 58142-10-2 is the registry number for Tessaric acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(2R,8S,8aR)-8,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl]prop-2-enoic acid (CAS 58142-10-2) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: 2-[(2R,8S,8aR)-8,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl]prop-2-enoic acid. InChIKey: GAWKUNMREBFQOL-ZVWUFJHRSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 2-[(2R,8S,8aR)-8,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl]prop-2-enoic acid |
| InChIKey | GAWKUNMREBFQOL-ZVWUFJHRSA-N |
| SMILES | C[C@H]1CC(=O)C=C2[C@@]1(C[C@@H](CC2)C(=C)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
TESSARIC ACID, orb1680240