CAS 58151-90-9 appears in our catalog under these names: Ribavirin Impurity E, Ribavirin Impurity 5, 5’-O-Benzoyl Ribavirin, 1-(5-O-Benzoyl-beta-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide (5'-O-Benzoylribavirin). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 4x25mg.
[(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate (CAS 58151-90-9) is a chemical compound with the molecular formula C15H16N4O6 and a molecular weight of 348.31 g/mol. IUPAC name: [(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate. InChIKey: DFCVOGPUXOBQKK-ZHSDAYTOSA-N.
| Molecular formula | C15H16N4O6 |
|---|---|
| Molecular weight | 348.31 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate |
| InChIKey | DFCVOGPUXOBQKK-ZHSDAYTOSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC(=N3)C(=O)N)O)O |
Computed by PubChem (NCBI)