CAS 58154-83-9 appears in our catalog under these names: Torasemide Impurity 40, Torasemide Impurity 27. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-[[1-hydroxy-4-(3-methylphenyl)imino-3-pyridinyl]sulfonyl]-3-propan-2-ylurea (CAS 58154-83-9) is a chemical compound with the molecular formula C16H20N4O4S and a molecular weight of 364.4 g/mol. IUPAC name: 1-[[1-hydroxy-4-(3-methylphenyl)imino-3-pyridinyl]sulfonyl]-3-propan-2-ylurea. InChIKey: PWDSFUZQRPIIEC-UHFFFAOYSA-N.
| Molecular formula | C16H20N4O4S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 1-[[1-hydroxy-4-(3-methylphenyl)imino-3-pyridinyl]sulfonyl]-3-propan-2-ylurea |
| InChIKey | PWDSFUZQRPIIEC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N=C2C=CN(C=C2S(=O)(=O)NC(=O)NC(C)C)O |
Computed by PubChem (NCBI)