CAS 582-53-6 appears in our catalog under these names: 3-(2,4,5-Trichlorophenoxy)propanoic acid, 95%, 3–(2,4,5–trichlorophenoxy)propionic acid, 3-(2,4,5-TRICHLOROPHENOXY)PROPANOIC ACID, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
3-(2,4,5-trichlorophenoxy)propanoic acid (CAS 582-53-6) is a chemical compound with the molecular formula C9H7Cl3O3 and a molecular weight of 269.5 g/mol. IUPAC name: 3-(2,4,5-trichlorophenoxy)propanoic acid. InChIKey: TZMWJEKNHBCUKP-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl3O3 |
|---|---|
| Molecular weight | 269.5 g/mol |
| IUPAC name | 3-(2,4,5-trichlorophenoxy)propanoic acid |
| InChIKey | TZMWJEKNHBCUKP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)OCCC(=O)O |
Computed by PubChem (NCBI)