Products 58238-28-1
CAS 58238-28-1 appears in our catalog under these names: Z–Asp(ONp)–OBzl, Z-Asp(ONp)-OBzl. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g.
1-O-benzyl 4-O-(4-nitrophenyl) 2-(phenylmethoxycarbonylamino)butanedioate (CAS 58238-28-1) is a chemical compound with the molecular formula C25H22N2O8 and a molecular weight of 478.4 g/mol. IUPAC name: 1-O-benzyl 4-O-(4-nitrophenyl) 2-(phenylmethoxycarbonylamino)butanedioate. InChIKey: HJTHSJRWEXIILP-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O8 |
|---|---|
| Molecular weight | 478.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-(4-nitrophenyl) 2-(phenylmethoxycarbonylamino)butanedioate |
| InChIKey | HJTHSJRWEXIILP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(CC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)