Products 58261-91-9
CAS 58261-91-9 appears in our catalog under these names: Mefenidil, Mefenidil/ 98.17% (existing batch purity), 2-(5-Methyl-2-phenyl-1H-imidazol-4-yl)acetonitrile. Offered by: Chemat Brand, TargetMol, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
2-(5-methyl-2-phenyl-1H-imidazol-4-yl)acetonitrile (CAS 58261-91-9) is a chemical compound with the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. IUPAC name: 2-(5-methyl-2-phenyl-1H-imidazol-4-yl)acetonitrile. InChIKey: OTRQRKIYHATFKM-UHFFFAOYSA-N.
| Molecular formula | C12H11N3 |
|---|---|
| Molecular weight | 197.24 g/mol |
| IUPAC name | 2-(5-methyl-2-phenyl-1H-imidazol-4-yl)acetonitrile |
| InChIKey | OTRQRKIYHATFKM-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N1)C2=CC=CC=C2)CC#N |
Computed by PubChem (NCBI)